Compound Q&A

What precautions should be taken when handling (6R,7R)-7-{[(2S)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 144790-28-3)?

Answer

(6R,7R)-7-{[(2S)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Handle this compound in a well-ventilated fume hood due to its potential toxicity and reactivity. Wear appropriate personal protective equipment (PPE) including gloves, laboratory coat, and safety goggles. Store in a cool, dry place away from heat sources. In case of spill, neutralize with a suitable base and dispose of according to local hazardous waste regulations. Refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name (6R,7R)-7-{[(2S)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C16H17N3O5S
Molecular Weight 363.4 g/mol
SMILES CC1=C(N2C(C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)SC1)C(=O)O
InChIKey BOEGTKLJZSQCCD-FIXISWKDSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is (6R,7R)-7-{[(2S)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 144790-28-3) typically synthesized?

This compound is synthesized through a multi-step process involving peptide coupling reactions and c...

Compound Q&A

What industries use (6R,7R)-7-{[(2S)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 144790-28-3)?

This compound is primarily used in the pharmaceutical industry for the development of novel drug can...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...