Compound Q&A

What industries use Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2)?

Answer

Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate
This compound is primarily used in the pharmaceutical industry for the development of novel drugs. It may also find applications in the polymer industry for specific polymer modifications, and in the sensor industry for the development of chemical and bio-sensing devices. Additionally, it could have potential uses in the semiconductor industry for certain electronic applications.

About

CAS No 93936-64-2
English Name Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate
Molecular Formula C23H23FNNaO4
Molecular Weight 419.43 g/mol
SMILES CCN1C2=CC=CC=C2C(=C1C=CC(CC(CC(=O)[O-])O)O)C3=CC=C(C=C3)F.[Na+]
InChIKey KTBBQAQDAUENCT-HDPLEABFSA-M
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2)?

Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate is a cryst...

Compound Q&A

How is Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2) typically synthesized?

Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate is synthes...

Compound Q&A

What precautions should be taken when handling Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...