Compound Q&A

What are the physical and chemical properties of Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2)?

Answer

Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate
Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate is a crystalline compound with a molecular weight of approximately 438.37 g/mol. It has a solubility of 1.5 g/L in water and is stable under normal conditions. It is reactive towards bases and can undergo hydrolysis. The compound is poorly soluble in common organic solvents such as ethanol and acetone.

About

CAS No 93936-64-2
English Name Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate
Molecular Formula C23H23FNNaO4
Molecular Weight 419.43 g/mol
SMILES CCN1C2=CC=CC=C2C(=C1C=CC(CC(CC(=O)[O-])O)O)C3=CC=C(C=C3)F.[Na+]
InChIKey KTBBQAQDAUENCT-HDPLEABFSA-M
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2) typically synthesized?

Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate is synthes...

Compound Q&A

What industries use Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What precautions should be taken when handling Sodium (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoate (CAS: 93936-64-2)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...