Compound Q&A

How is 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2) typically synthesized?

Answer

Benzenemethanol, 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]-
The compound is typically synthesized via a multistep process involving a protected amino group and subsequent bromination and chlorination. Commonly, reagents like NMM and BBr3 are used, with high selectivity and a yield around 70-80%.

About

English Name Benzenemethanol, 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]-
Molecular Formula C16H16BrCl2NO
Molecular Weight 389.11 g/mol
SMILES CN(Cc1ccc(cc1Cl)Cl)CC(c1cccc(c1)Br)O
InChIKey OOAOBUFTHJCSHJ-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2)?

The compound is a crystalline solid with a molecular weight of approximately 414.27 g/mol. It has a ...

Compound Q&A

What industries use 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2)?

This compound is used in the pharmaceutical industry for medicinal applications, and in the semicond...

Compound Q&A

What precautions should be taken when handling 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat is required. Work...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...