Compound Q&A

What are the physical and chemical properties of 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2)?

Answer

Benzenemethanol, 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]-
The compound is a crystalline solid with a molecular weight of approximately 414.27 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is less reactive than other similar compounds due to the presence of bromine and dichlorophenyl groups.

About

English Name Benzenemethanol, 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]-
Molecular Formula C16H16BrCl2NO
Molecular Weight 389.11 g/mol
SMILES CN(Cc1ccc(cc1Cl)Cl)CC(c1cccc(c1)Br)O
InChIKey OOAOBUFTHJCSHJ-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2) typically synthesized?

The compound is typically synthesized via a multistep process involving a protected amino group and ...

Compound Q&A

What industries use 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2)?

This compound is used in the pharmaceutical industry for medicinal applications, and in the semicond...

Compound Q&A

What precautions should be taken when handling 3-bromo-α-[[[(2,4-dichlorophenyl)methyl]methylamino]methyl]benzenemethanol (CAS: 1234366-97-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat is required. Work...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...