Compound Q&A

What precautions should be taken when handling (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8)?

Answer

(1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine}
When handling this compound, chemical resistance gloves such as nitrile or butyl should be used. Ensure that the work is conducted in a well-ventilated area or a fume hood to avoid inhalation of vapors. Spills should be cleaned up promptly with appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine}
Molecular Formula C29H35N3
Molecular Weight 425.62 g/mol
SMILES CC(=NC1=CC=CC=C1C(C)(C)C)C1=CC=CC(=N1)/C(/C)=N\C1=CC=CC=C1C(C)(C)C
InChIKey MDJXUNXXZJTMDW-GYNALDAISA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8)?

The compound (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} is cry...

Compound Q&A

How is (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8) typically synthesized?

This compound can be synthesized via a multi-step process involving the reaction of 2,6-pyridinedica...

Compound Q&A

What industries use (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8)?

The compound is used in various industries, including pharmaceuticals, where it serves as a precurso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...