Compound Q&A

What industries use (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8)?

Answer

(1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine}
The compound is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis, and in polymer applications, enhancing the thermal stability and mechanical properties of polymers. It also finds use in the development of sensors and as a material in semiconductor fabrication processes.

About

English Name (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine}
Molecular Formula C29H35N3
Molecular Weight 425.62 g/mol
SMILES CC(=NC1=CC=CC=C1C(C)(C)C)C1=CC=CC(=N1)/C(/C)=N\C1=CC=CC=C1C(C)(C)C
InChIKey MDJXUNXXZJTMDW-GYNALDAISA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8)?

The compound (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} is cry...

Compound Q&A

How is (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8) typically synthesized?

This compound can be synthesized via a multi-step process involving the reaction of 2,6-pyridinedica...

Compound Q&A

What precautions should be taken when handling (1Z,1'E)-1,1'-(2,6-Pyridinediyl)bis{N-[2-(2-methyl-2-propanyl)phenyl]ethanimine} (CAS: 204203-17-8)?

When handling this compound, chemical resistance gloves such as nitrile or butyl should be used. Ens...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...