Compound Q&A

What precautions should be taken when handling Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8)?

Answer

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate
When handling Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. This compound should be stored in a fume hood to avoid exposure to air and moisture. Any spills should be cleaned up immediately using appropriate absorbent materials and following the safety data sheet (SDS) guidelines. Proper disposal methods should be followed to ensure environmental safety.

About

CAS No 58237-86-8
English Name Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate
Molecular Formula C12H15NO5
Molecular Weight 253.25 g/mol
SMILES COC(C(=O)OC)NC(=O)OCC1=CC=CC=C1
InChIKey NNBQAZBSJUATDO-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8)?

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) is a white crystalline solid w...

Compound Q&A

How is Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) typically synthesized?

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) can be synthesized via a multi...

Compound Q&A

What industries use Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8)?

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) is used in various industries....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...