Compound Q&A

What industries use Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8)?

Answer

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate
Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) is used in various industries. It is commonly employed in the pharmaceutical sector for the synthesis of certain drugs. Additionally, it has applications in polymer chemistry, where it serves as a functional monomer. Other industries include sensors and semiconductors, where its reactive nature makes it useful for specific chemical modifications.

About

CAS No 58237-86-8
English Name Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate
Molecular Formula C12H15NO5
Molecular Weight 253.25 g/mol
SMILES COC(C(=O)OC)NC(=O)OCC1=CC=CC=C1
InChIKey NNBQAZBSJUATDO-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8)?

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) is a white crystalline solid w...

Compound Q&A

How is Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) typically synthesized?

Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8) can be synthesized via a multi...

Compound Q&A

What precautions should be taken when handling Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8)?

When handling Methyl {[(benzyloxy)carbonyl]amino}(methoxy)acetate (CAS: 58237-86-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...