Compound Q&A

What industries use 4-[(E)-(4-Carbamoylphenyl)diazenyl]-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide (CAS: 36968-27-1)?

Answer

4-[(E)-(4-Carbamoylphenyl)diazenyl]-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide
This compound is primarily used in the pharmaceutical industry for developing new drugs and in the production of advanced materials. It is also explored for its use in sensor technologies due to its unique optical and electronic properties. Additionally, its potential in semiconductor applications is being researched, making it a versatile compound across various scientific and industrial sectors.

About

CAS No 36968-27-1
English Name 4-[(E)-(4-Carbamoylphenyl)diazenyl]-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide
Molecular Formula C25H20N4O4
Molecular Weight 440.46 g/mol
SMILES COc4ccccc4NC(=O)c3cc1ccccc1c(/N=N/c2ccc(cc2)C(N)=O)c3O
InChIKey HULNYTPFPARJMG-ZQHSETAFSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(E)-(4-Carbamoylphenyl)diazenyl]-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide (CAS: 36968-27-1)?

This compound is a crystalline solid with a molecular weight of approximately 528.4 g/mol. It is sli...

Compound Q&A

How is 4-[(E)-(4-Carbamoylphenyl)diazenyl]-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide (CAS: 36968-27-1) typically synthesized?

This compound is usually synthesized through a multi-step process involving diazotization, coupling,...

Compound Q&A

What precautions should be taken when handling 4-[(E)-(4-Carbamoylphenyl)diazenyl]-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide (CAS: 36968-27-1)?

When handling this compound, it is important to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...