Compound Q&A

What industries use 2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid (CAS: 815593-60-3)?

Answer

2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid
2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid is used in the pharmaceutical industry for the synthesis of complex molecules, particularly those containing a piperidine ring. It is also used in the polymer industry for the development of new materials and in sensors for its specific reactivity towards certain functional groups.

About

English Name 2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CC(C1CCN(CC1)C(=O)OC(C)(C)C)C(=O)O
InChIKey FZNNOLMIECALJP-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid (CAS: 815593-60-3)?

2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid is a white crystalline solid with a molecula...

Compound Q&A

How is 2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid (CAS: 815593-60-3) typically synthesized?

2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid is typically synthesized via a multi-step pr...

Compound Q&A

What precautions should be taken when handling 2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid (CAS: 815593-60-3)?

When handling 2-[1-(Tert-butoxycarbonyl)piperidin-4-yl]propanoic acid, wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...