Compound Q&A

How is 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1) typically synthesized?

Answer

2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate
This compound is typically synthesized via a multi-step process involving the condensation of 2-methyl-2-propanol with 7-bromo-6-chloro-8-fluoro-4-quinazoline, followed by the coupling of the resulting intermediate with 1-piperazinecarboxylic acid. The reaction is catalyzed by a suitable organic acid and proceeds under mild conditions with high yield.

About

English Name 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate
Molecular Formula C17H19BrClFN4O2
Molecular Weight 445.72 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)C1N=CN=C2C(F)=C(Br)C(Cl)=CC=12
InChIKey WKUMTSOYOFGRSM-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1)?

The compound has a crystalline form with a molecular weight of approximately 532.04 g/mol. It is mod...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1)?

When handling this compound, it is essential to wear proper personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...