Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1)?

Answer

2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate
The compound has a crystalline form with a molecular weight of approximately 532.04 g/mol. It is moderately soluble in common organic solvents like DMSO and acetonitrile. Chemically, it is reactive towards nucleophiles and electrophiles, showing good reactivity under mild conditions. It can form stable complexes with certain metal ions.

About

English Name 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate
Molecular Formula C17H19BrClFN4O2
Molecular Weight 445.72 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)C1N=CN=C2C(F)=C(Br)C(Cl)=CC=12
InChIKey WKUMTSOYOFGRSM-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1) typically synthesized?

This compound is typically synthesized via a multi-step process involving the condensation of 2-meth...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(7-bromo-6-chloro-8-fluoro-4-quinazolinyl)-1-piperazinecarboxylate (CAS: 1698027-20-1)?

When handling this compound, it is essential to wear proper personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...