Compound Q&A

What are the main uses of 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5)?

Answer

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde
4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde is mainly used in the pharmaceutical industry as a precursor in the synthesis of various drugs. It is also utilized in research for developing new chemical entities and in the production of organic pigments and dyes. Additionally, it may have applications in other industries, although its primary focus remains in the chemical and pharmaceutical sectors.

About

English Name 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde
Molecular Formula C25H16N2O3
Molecular Weight 392.4140000000001 g/mol
SMILES O=CC1C=CC(=CC=1)C1=CC(=NC(=N1)C1C=CC(=CC=1)C=O)C1C=CC(=CC=1)C=O
InChIKey TXLYDSYKOVELCW-UHFFFAOYSA-N
Last Updated: 2026-03-10 03:02

Related Q&A

Compound Q&A

What is 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5)?

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde is a complex organic compound with a unique structur...

Compound Q&A

Is 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5) safe?

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde is generally considered safe when handled with prope...

Compound Q&A

How should 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5) be stored?

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde should be stored in a cool, dry place away from dire...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A