Compound Q&A

What is 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5)?

Answer

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde
4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde is a complex organic compound with a unique structure. It is a triaryl derivative featuring three benzaldehyde units linked by pyrimidine bridges. This compound is odorless and has a molecular weight of approximately 480.4 g/mol. Its properties include a melting point of 164-165°C and solubility in common organic solvents. This compound is primarily used in pharmaceuticals and research for its potential in drug synthesis and as a chemical intermediate.

About

English Name 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde
Molecular Formula C25H16N2O3
Molecular Weight 392.4140000000001 g/mol
SMILES O=CC1C=CC(=CC=1)C1=CC(=NC(=N1)C1C=CC(=CC=1)C=O)C1C=CC(=CC=1)C=O
InChIKey TXLYDSYKOVELCW-UHFFFAOYSA-N
Last Updated: 2026-03-10 03:02

Related Q&A

Compound Q&A

What are the main uses of 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5)?

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde is mainly used in the pharmaceutical industry as a p...

Compound Q&A

Is 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5) safe?

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde is generally considered safe when handled with prope...

Compound Q&A

How should 4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde (CAS: 2230887-23-5) be stored?

4,4',4''-(2,4,6-Pyrimidinetriyl)tribenzaldehyde should be stored in a cool, dry place away from dire...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A