Compound Q&A

What is Mono-POC Isopropyl Tenofovir (CAS: 1246812-40-7)?

Answer

Mono-POC Isopropyl Tenofovir
Mono-POC Isopropyl Tenofovir is a chemical compound with CAS number 1246812-40-7. It is a derivative of tenofovir, which is used in antiretroviral therapy. This compound is characterized by its unique structure, which includes a mono-phosphoramidate ester linkage and isopropyl substitution, making it a potential candidate for various applications in pharmaceuticals and research.

About

English Name Mono-POC Isopropyl Tenofovir
Molecular Formula C17H28N5O7P
Molecular Weight 445.41 g/mol
SMILES CC(C)OC(=O)OCOP(=O)(COC(C)CN1C=NC2=C(N=CN=C21)N)OC(C)C
InChIKey IHJDJJPKNNEZLC-SGSXECEGSA-N
Last Updated: 2026-03-09 22:46

Related Q&A

Compound Q&A

What are the main uses of Mono-POC Isopropyl Tenofovir (CAS: 1246812-40-7)?

Mono-POC Isopropyl Tenofovir is primarily used in pharmaceutical research and development, particula...

Compound Q&A

Is Mono-POC Isopropyl Tenofovir (CAS: 1246812-40-7) safe?

Mono-POC Isopropyl Tenofovir is generally considered safe when handled under appropriate conditions....

Compound Q&A

How should Mono-POC Isopropyl Tenofovir (CAS: 1246812-40-7) be stored?

Mono-POC Isopropyl Tenofovir should be stored in a dry, cool place away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...