Compound Q&A

How should 2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) be stored?

Answer

2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate
2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) should be stored in a cool, dry place, ideally at room temperature (15-25°C), and protected from direct sunlight. The compound should be kept in a sealed container to prevent moisture absorption. It is important to avoid storing it in high humidity or high-temperature environments to maintain its stability and reactivity.

About

English Name 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES O=C(OC(C)(C)C)NC1=CC2=C(NCC2)C=C1
InChIKey PCEAUMPCFBPXKL-UHFFFAOYSA-N
Last Updated: 2026-03-09 13:41

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4)?

2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate is a chemical compound with the CAS number 88...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4)?

2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate is primarily used in the pharmaceutical indus...

Compound Q&A

Is 2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) safe?

2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) is generally considered saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...