Compound Q&A

Is 2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) safe?

Answer

2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate
2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) is generally considered safe when handled with appropriate precautions. However, it should be stored in a cool, dry place and away from direct sunlight. Protective equipment such as gloves and goggles should be worn during handling to prevent skin and eye contact. Inhalation of the compound should be avoided.

About

English Name 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES O=C(OC(C)(C)C)NC1=CC2=C(NCC2)C=C1
InChIKey PCEAUMPCFBPXKL-UHFFFAOYSA-N
Last Updated: 2026-03-09 13:41

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4)?

2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate is a chemical compound with the CAS number 88...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4)?

2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate is primarily used in the pharmaceutical indus...

Compound Q&A

How should 2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) be stored?

2-Methyl-2-proanyl 2,3-dihydro-1H-indol-5-ylcarbamate (CAS: 885270-06-4) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...