Compound Q&A

What precautions should be taken when handling (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3)?

Answer

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate
When handling (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate, it is essential to wear proper personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The substance should be handled in a well-ventilated area or inside a fume hood due to its potential to release volatile components. In case of a spill, use appropriate spill cleanup materials and follow local safety regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate
Molecular Formula C19H14F3IO3S2
Molecular Weight 538.3 g/mol
SMILES C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=C(C=C3)I.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey WHQDLCHSPLKATA-UHFFFAOYSA-M
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3)?

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate is a crystalline solid with a molecular ...

Compound Q&A

How is (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3) typically synthesized?

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate can be synthesized by reacting 4-iodophe...

Compound Q&A

What industries use (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3)?

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate is used in various industries, particula...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...