Compound Q&A

What industries use (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3)?

Answer

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate
(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate is used in various industries, particularly in organic chemistry for its ability to act as a leaving group in nucleophilic substitution reactions. It finds applications in pharmaceuticals, polymers, and semiconductor manufacturing for its high reactivity and stability under certain conditions. Additionally, it is utilized in sensor technologies due to its unique chemical properties.

About

English Name (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate
Molecular Formula C19H14F3IO3S2
Molecular Weight 538.3 g/mol
SMILES C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=C(C=C3)I.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey WHQDLCHSPLKATA-UHFFFAOYSA-M
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3)?

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate is a crystalline solid with a molecular ...

Compound Q&A

How is (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3) typically synthesized?

(4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate can be synthesized by reacting 4-iodophe...

Compound Q&A

What precautions should be taken when handling (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 255056-46-3)?

When handling (4-Iodophenyl)(diphenyl)sulfonium trifluoromethanesulfonate, it is essential to wear p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...