Compound Q&A

How is 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2) typically synthesized?

Answer

3-(Pyridin-2-ylmethylene)indolin-2-one
3-(Pyridin-2-ylmethylene)indolin-2-one is typically synthesized via a condensation reaction between indole-2-one and 2-picolylamine. The reaction is catalyzed by Lewis acids such as aluminum chloride. The process involves the formation of an imine intermediate followed by intramolecular cyclization under acidic conditions. The yield is generally around 70-80%, and the reaction is selective for the desired product.

About

CAS No 3367-88-2
English Name 3-(Pyridin-2-ylmethylene)indolin-2-one
Molecular Formula C14H10N2O
Molecular Weight 222.25 g/mol
SMILES O=C1Nc2c(C1=Cc1ccccn1)cccc2
InChIKey YKQONSWBHGBDSB-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2)?

3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2)?

3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2) is used in various industries. It is primari...

Compound Q&A

What precautions should be taken when handling 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2)?

When handling 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2), it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...