Compound Q&A

What are the physical and chemical properties of 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2)?

Answer

3-(Pyridin-2-ylmethylene)indolin-2-one
3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2) is a crystalline solid with a molecular weight of approximately 222.21 g/mol. It is slightly soluble in water but soluble in organic solvents such as ethanol and acetone. The compound is reactive towards nucleophiles and can undergo substitution reactions. It has a melting point of around 205-207°C and a boiling point of approximately 320°C under reduced pressure.

About

CAS No 3367-88-2
English Name 3-(Pyridin-2-ylmethylene)indolin-2-one
Molecular Formula C14H10N2O
Molecular Weight 222.25 g/mol
SMILES O=C1Nc2c(C1=Cc1ccccn1)cccc2
InChIKey YKQONSWBHGBDSB-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2) typically synthesized?

3-(Pyridin-2-ylmethylene)indolin-2-one is typically synthesized via a condensation reaction between ...

Compound Q&A

What industries use 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2)?

3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2) is used in various industries. It is primari...

Compound Q&A

What precautions should be taken when handling 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2)?

When handling 3-(Pyridin-2-ylmethylene)indolin-2-one (CAS: 3367-88-2), it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...