Compound Q&A

What precautions should be taken when handling 2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile (CAS: 131801-69-9)?

Answer

2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile
When handling 2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. It should be stored in a fume hood and away from heat sources. In case of a spill, the area should be ventilated, and the spill should be cleaned up carefully using appropriate materials. The material safety data sheet (MSDS) or safety data sheet (SDS) should be consulted for detailed handling and disposal instructions.

About

English Name 2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile
Molecular Formula C15H19NO2
Molecular Weight 245.32 g/mol
SMILES COC1=CC=C(C=C1)C(C#N)C2(CCCCC2)O
InChIKey ASYJSBPNAIDUHX-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile (CAS: 131801-69-9)?

2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile is a colorless to light yellow liquid with a...

Compound Q&A

How is 2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile (CAS: 131801-69-9) typically synthesized?

2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile is typically synthesized via a multistep pro...

Compound Q&A

What industries use 2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile (CAS: 131801-69-9)?

2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile is used in various industries, including pha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...