Compound Q&A

How is 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5) typically synthesized?

Answer

4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate
4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate is typically synthesized via a multistep process involving the coupling of a cyanophenyl group with a benzoate derivative. Commonly, the reaction is catalyzed by palladium-based complexes under microwave-assisted conditions. The yield is generally high, and the reaction is selective, ensuring the formation of the desired product.

About

CAS No 89331-97-5
English Name 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate
Molecular Formula C22H23NO2
Molecular Weight 333.4 g/mol
SMILES CCC1CCC(CC1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C#N
InChIKey QSXYPHAWOSQCHP-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5)?

4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5)?

4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate is used in the pharmaceutical industry for the dev...

Compound Q&A

What precautions should be taken when handling 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5)?

When handling 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate, it is crucial to wear personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...