Compound Q&A

What are the physical and chemical properties of 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5)?

Answer

4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate
4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate is a white crystalline solid with a molecular weight of approximately 361.37 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound is relatively stable but can react with strong reducing agents. It is used in various applications requiring specific chemical properties.

About

CAS No 89331-97-5
English Name 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate
Molecular Formula C22H23NO2
Molecular Weight 333.4 g/mol
SMILES CCC1CCC(CC1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C#N
InChIKey QSXYPHAWOSQCHP-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5) typically synthesized?

4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate is typically synthesized via a multistep process i...

Compound Q&A

What industries use 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5)?

4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate is used in the pharmaceutical industry for the dev...

Compound Q&A

What precautions should be taken when handling 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate (CAS: 89331-97-5)?

When handling 4-Cyanophenyl 4-(trans-4-ethylcyclohexyl)benzoate, it is crucial to wear personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...