Compound Q&A

What industries use (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

Answer

(5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid
This compound is used in various industries, including pharmaceuticals for its anti-inflammatory and anti-allergic properties, and in research for its potential as a biomarker in inflammation and cardiovascular diseases. It also has applications in the production of advanced polymers and as a feedstock for the synthesis of other bioactive compounds. Additionally, it is explored in the development of novel sensors and in semiconductor research for its unique chemical and physical properties.

About

CAS No 84807-87-4
English Name (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid
Molecular Formula C20H24D8O3
Molecular Weight 328.521814224 g/mol
SMILES CCCCCC(C=CC=CCC=CCC=CCCCC(=O)O)O
InChIKey JSFATNQSLKRBCI-JCAMWLGVSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

This compound is a hydroxylated derivative of a conjugated polyunsaturated fatty acid. It is a white...

Compound Q&A

How is (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4) typically synthesized?

This compound can be synthesized through various methods, including chemical synthesis and enzymatic...

Compound Q&A

What precautions should be taken when handling (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

When handling this compound, it is important to take appropriate personal protective equipment (PPE)...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1,2-bis(4-methylphenyl)ethanone (CAS: 71193-32-3)?

When handling 2-Chloro-1,2-bis(4-methylphenyl)ethanone (CAS: 71193-32-3), it is ...

71193-32-32-Chloro-1,2-bis(4-m...
Compound Q&A

What industries use 4-Ethoxy-3-(5-methyl-4-oxo-7-propyl-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonyl chloride (CAS: 224789-26-8)?

4-Ethoxy-3-(5-methyl-4-oxo-7-propyl-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-yl...

224789-26-84-Ethoxy-3-(5-methyl...
Compound Q&A

How should Methyl 3-Oxo-4-Androsten-17-Carboxylate (CAS: 2681-55-2) be stored?

Methyl 3-Oxo-4-Androsten-17-Carboxylate (CAS: 2681-55-2) should be stored in a c...

2681-55-2Methyl 3-Oxo-4-Andro...
Compound Q&A

What are the main uses of (R)-3-Amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid (CAS: 909725-61-7)?

(R)-3-Amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid is primarily used i...

909725-61-7(R)-3-Amino-4-(3-hex...