Compound Q&A

How is (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4) typically synthesized?

Answer

(5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid
This compound can be synthesized through various methods, including chemical synthesis and enzymatic reactions. Common synthetic routes involve the introduction of a hydroxyl group at the 15th position of the icosatetraenoic acid backbone. Enzymatic methods can provide higher selectivity and yield, often using enzymes like lipoxygenases or hydroxylases. These reactions typically require careful control of temperature and pH to achieve high yields and selectivity.

About

CAS No 84807-87-4
English Name (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid
Molecular Formula C20H24D8O3
Molecular Weight 328.521814224 g/mol
SMILES CCCCCC(C=CC=CCC=CCC=CCCCC(=O)O)O
InChIKey JSFATNQSLKRBCI-JCAMWLGVSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

This compound is a hydroxylated derivative of a conjugated polyunsaturated fatty acid. It is a white...

Compound Q&A

What industries use (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

This compound is used in various industries, including pharmaceuticals for its anti-inflammatory and...

Compound Q&A

What precautions should be taken when handling (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

When handling this compound, it is important to take appropriate personal protective equipment (PPE)...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1,2-bis(4-methylphenyl)ethanone (CAS: 71193-32-3)?

When handling 2-Chloro-1,2-bis(4-methylphenyl)ethanone (CAS: 71193-32-3), it is ...

71193-32-32-Chloro-1,2-bis(4-m...
Compound Q&A

What industries use 4-Ethoxy-3-(5-methyl-4-oxo-7-propyl-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonyl chloride (CAS: 224789-26-8)?

4-Ethoxy-3-(5-methyl-4-oxo-7-propyl-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-yl...

224789-26-84-Ethoxy-3-(5-methyl...
Compound Q&A

How should Methyl 3-Oxo-4-Androsten-17-Carboxylate (CAS: 2681-55-2) be stored?

Methyl 3-Oxo-4-Androsten-17-Carboxylate (CAS: 2681-55-2) should be stored in a c...

2681-55-2Methyl 3-Oxo-4-Andro...
Compound Q&A

What are the main uses of (R)-3-Amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid (CAS: 909725-61-7)?

(R)-3-Amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid is primarily used i...

909725-61-7(R)-3-Amino-4-(3-hex...