Compound Q&A

What are the physical and chemical properties of (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

Answer

(5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid
This compound is a hydroxylated derivative of a conjugated polyunsaturated fatty acid. It is a white crystalline solid with a molecular weight of approximately 528.5 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and chloroform. It exhibits moderate reactivity towards basic and acidic conditions. This compound is known for its stability under neutral conditions, but caution is advised against prolonged exposure to extreme pH environments.

About

CAS No 84807-87-4
English Name (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid
Molecular Formula C20H24D8O3
Molecular Weight 328.521814224 g/mol
SMILES CCCCCC(C=CC=CCC=CCC=CCCCC(=O)O)O
InChIKey JSFATNQSLKRBCI-JCAMWLGVSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4) typically synthesized?

This compound can be synthesized through various methods, including chemical synthesis and enzymatic...

Compound Q&A

What industries use (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

This compound is used in various industries, including pharmaceuticals for its anti-inflammatory and...

Compound Q&A

What precautions should be taken when handling (5Z,8Z,11Z,13E,15S)-15-Hydroxy(5,6,8,9,11,12,14,15-~2~H_8_)-5,8,11,13-icosatetraenoic acid (CAS: 84807-87-4)?

When handling this compound, it is important to take appropriate personal protective equipment (PPE)...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1,2-bis(4-methylphenyl)ethanone (CAS: 71193-32-3)?

When handling 2-Chloro-1,2-bis(4-methylphenyl)ethanone (CAS: 71193-32-3), it is ...

71193-32-32-Chloro-1,2-bis(4-m...
Compound Q&A

What industries use 4-Ethoxy-3-(5-methyl-4-oxo-7-propyl-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-yl)benzenesulfonyl chloride (CAS: 224789-26-8)?

4-Ethoxy-3-(5-methyl-4-oxo-7-propyl-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-yl...

224789-26-84-Ethoxy-3-(5-methyl...
Compound Q&A

How should Methyl 3-Oxo-4-Androsten-17-Carboxylate (CAS: 2681-55-2) be stored?

Methyl 3-Oxo-4-Androsten-17-Carboxylate (CAS: 2681-55-2) should be stored in a c...

2681-55-2Methyl 3-Oxo-4-Andro...
Compound Q&A

What are the main uses of (R)-3-Amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid (CAS: 909725-61-7)?

(R)-3-Amino-4-(3-hexylphenylamino)-4-oxobutylphosphonic acid is primarily used i...

909725-61-7(R)-3-Amino-4-(3-hex...