Compound Q&A

What industries use 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3)?

Answer

1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylicacid, hydrobromide, (S)- (9CI)
1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- is primarily used in the pharmaceutical industry for the synthesis of complex organic compounds. It also finds applications in the polymer industry for the development of functional polymers. Additionally, it has potential uses in sensors and semiconductors for its unique chemical properties.

About

CAS No 75776-79-3
English Name 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylicacid, hydrobromide, (S)- (9CI)
Molecular Formula C7H12BrNO2S2
Molecular Weight 286.2 g/mol
SMILES C1CSC2(S1)CC(NC2)C(=O)O.Br
InChIKey DXALUCGGSBGKIY-JEDNCBNOSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3)?

1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- is a crystalline solid with a...

Compound Q&A

How is 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3) typically synthesized?

1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- is typically synthesized thro...

Compound Q&A

What precautions should be taken when handling 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3)?

When handling 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)-, it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...