Compound Q&A

How is 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3) typically synthesized?

Answer

1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylicacid, hydrobromide, (S)- (9CI)
1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- is typically synthesized through a multi-step process involving the condensation of 1,4-dithiane and 1,4-diazaspiro[4.4]nonane, followed by bromination. The reaction is catalyzed by a Lewis acid such as aluminum chloride, and the product is isolated and purified by recrystallization. The overall yield is around 70%.

About

CAS No 75776-79-3
English Name 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylicacid, hydrobromide, (S)- (9CI)
Molecular Formula C7H12BrNO2S2
Molecular Weight 286.2 g/mol
SMILES C1CSC2(S1)CC(NC2)C(=O)O.Br
InChIKey DXALUCGGSBGKIY-JEDNCBNOSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3)?

1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- is a crystalline solid with a...

Compound Q&A

What industries use 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3)?

1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)- (CAS: 75776-79-3)?

When handling 1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid, hydrobromide, (S)-, it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...