Compound Q&A

What industries use 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0)?

Answer

4-Iodo-3-(trifluoromethoxy)benzoic acid
4-Iodo-3-(trifluoromethoxy)benzoic acid finds application in the pharmaceutical industry, where it may be used as an intermediate in the synthesis of medicinal compounds. It is also relevant in the polymer industry for the development of specialized polymers and in the electronics industry for the production of certain types of sensors and semiconductors due to its unique chemical properties.

About

English Name 4-Iodo-3-(trifluoromethoxy)benzoic acid
Molecular Formula C8H4F3IO3
Molecular Weight 332.02 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)I
InChIKey YZYRBLQNCPKVHL-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0)?

4-Iodo-3-(trifluoromethoxy)benzoic acid is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0) typically synthesized?

4-Iodo-3-(trifluoromethoxy)benzoic acid is commonly synthesized via the iodination of 3-(trifluorome...

Compound Q&A

What precautions should be taken when handling 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0)?

When handling 4-Iodo-3-(trifluoromethoxy)benzoic acid, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...