Compound Q&A

How is 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0) typically synthesized?

Answer

4-Iodo-3-(trifluoromethoxy)benzoic acid
4-Iodo-3-(trifluoromethoxy)benzoic acid is commonly synthesized via the iodination of 3-(trifluoromethoxy)benzoic acid with iodine in the presence of a base like sodium hydride. The reaction is typically carried out in a solvent such as dimethylformamide (DMF) and involves the formation of an ionic intermediate which then undergoes acid-base protonation to form the final product.

About

English Name 4-Iodo-3-(trifluoromethoxy)benzoic acid
Molecular Formula C8H4F3IO3
Molecular Weight 332.02 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)I
InChIKey YZYRBLQNCPKVHL-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0)?

4-Iodo-3-(trifluoromethoxy)benzoic acid is a white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0)?

4-Iodo-3-(trifluoromethoxy)benzoic acid finds application in the pharmaceutical industry, where it m...

Compound Q&A

What precautions should be taken when handling 4-Iodo-3-(trifluoromethoxy)benzoic acid (CAS: 886762-67-0)?

When handling 4-Iodo-3-(trifluoromethoxy)benzoic acid, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...