Compound Q&A

How is Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9) typically synthesized?

Answer

Chloro(3,4-dimethoxybenzyl)zinc
Chloro(3,4-dimethoxybenzyl)zinc is synthesized through a Grignard reaction where 3,4-dimethoxybenzyl chloride reacts with zinc in an organic solvent like THF. The reaction requires magnesium chloride in diethyl ether to facilitate the formation of the Grignard reagent with high yield and selectivity.

About

English Name Chloro(3,4-dimethoxybenzyl)zinc
Molecular Formula C9H11ClO2Zn
Molecular Weight 252.03 g/mol
SMILES COC1=C(C=C(C=C1)[CH2-])OC.Cl[Zn+]
InChIKey QVBFKWSHYBNLNP-UHFFFAOYSA-M
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9)?

Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9)?

Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9) is primarily used in the pharmaceutical and organ...

Compound Q&A

What precautions should be taken when handling Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9)?

When handling Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...