Compound Q&A

What are the physical and chemical properties of Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9)?

Answer

Chloro(3,4-dimethoxybenzyl)zinc
Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9) is a crystalline solid with a molecular weight of approximately 314.33 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is reactive, particularly towards nucleophiles, and can undergo substitution reactions easily.

About

English Name Chloro(3,4-dimethoxybenzyl)zinc
Molecular Formula C9H11ClO2Zn
Molecular Weight 252.03 g/mol
SMILES COC1=C(C=C(C=C1)[CH2-])OC.Cl[Zn+]
InChIKey QVBFKWSHYBNLNP-UHFFFAOYSA-M
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9) typically synthesized?

Chloro(3,4-dimethoxybenzyl)zinc is synthesized through a Grignard reaction where 3,4-dimethoxybenzyl...

Compound Q&A

What industries use Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9)?

Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9) is primarily used in the pharmaceutical and organ...

Compound Q&A

What precautions should be taken when handling Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9)?

When handling Chloro(3,4-dimethoxybenzyl)zinc (CAS: 307531-79-9), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...