Compound Q&A

How is Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) typically synthesized?

Answer

Biotin-PEG2-C4-alkyne
Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) is synthesized by linking a biotin moiety to a polyethylene glycol (PEG) chain through a C4 alkynyl group. Commonly, biotin is attached to the PEG chain via an amide bond. The synthesis typically involves coupling biotin hydrazide with the carboxylic acid of the C4 alkynyl-PEG2 derivative. This process can be optimized using specific coupling agents and conditions to achieve high yields and selectivity.

About

English Name Biotin-PEG2-C4-alkyne
Molecular Formula C22H36N4O5S
Molecular Weight 16.043 g/mol
SMILES C#CCCCC(=O)NCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2
InChIKey VNWKTOKETHGBQD-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2)?

Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) is a biotinylated polyethylene glycol derivative with a C4...

Compound Q&A

What industries use Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2)?

Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) is widely used in the pharmaceutical, biotechnology, and d...

Compound Q&A

What precautions should be taken when handling Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2)?

When handling Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2), it is crucial to use appropriate personal p...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...