Compound Q&A

What are the physical and chemical properties of Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2)?

Answer

Biotin-PEG2-C4-alkyne
Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) is a biotinylated polyethylene glycol derivative with a C4 alkynyl group. It is typically a white to off-white powder with a molecular weight around 615 g/mol. This compound is poorly soluble in water but soluble in organic solvents such as DMSO and CHCl3. It is reactive due to the presence of the alkynyl group, which can undergo copper-catalyzed azide-alkyne click chemistry, making it useful for conjugation reactions.

About

English Name Biotin-PEG2-C4-alkyne
Molecular Formula C22H36N4O5S
Molecular Weight 16.043 g/mol
SMILES C#CCCCC(=O)NCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2
InChIKey VNWKTOKETHGBQD-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) typically synthesized?

Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) is synthesized by linking a biotin moiety to a polyethylen...

Compound Q&A

What industries use Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2)?

Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2) is widely used in the pharmaceutical, biotechnology, and d...

Compound Q&A

What precautions should be taken when handling Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2)?

When handling Biotin-PEG2-C4-alkyne (CAS: 1011268-28-2), it is crucial to use appropriate personal p...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...