Compound Q&A

How is Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6) typically synthesized?

Answer

Mono-Cyclohexyl Phthalate-3,4,5,6-d
Mono-Cyclohexyl Phthalate-3,4,5,6-d is typically synthesized through the esterification of phthalic anhydride and cyclohexanol. The reaction is catalyzed by an acid, such as sulfuric acid, at elevated temperatures. The process involves the formation of the ester bond between the phthalic anhydride and cyclohexanol. The yield is generally high, and the product is isolated by washing and drying steps.

About

English Name Mono-Cyclohexyl Phthalate-3,4,5,6-d
Molecular Formula C14H15O4-
Molecular Weight 252.3 g/mol
SMILES c1([2H])c([2H])c([2H])c(c(c1[2H])C(=O)OC1CCCCC1)C(=O)O
InChIKey PMDKYLLIOLFQPO-DOGSKSIHSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6)?

Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6) is a clear, colorless liquid with a molecula...

Compound Q&A

What industries use Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6)?

Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6) is used in various industries, including pol...

Compound Q&A

What precautions should be taken when handling Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6)?

When handling Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...