Compound Q&A

What are the physical and chemical properties of Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6)?

Answer

Mono-Cyclohexyl Phthalate-3,4,5,6-d
Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6) is a clear, colorless liquid with a molecular weight of approximately 292.45 g/mol. It has a solubility in water of less than 1 g/L at 20°C. Chemically, it is relatively stable but can undergo mild hydrolysis in the presence of water and strong acids or bases. The compound is miscible with most organic solvents and has a slight odor.

About

English Name Mono-Cyclohexyl Phthalate-3,4,5,6-d
Molecular Formula C14H15O4-
Molecular Weight 252.3 g/mol
SMILES c1([2H])c([2H])c([2H])c(c(c1[2H])C(=O)OC1CCCCC1)C(=O)O
InChIKey PMDKYLLIOLFQPO-DOGSKSIHSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6) typically synthesized?

Mono-Cyclohexyl Phthalate-3,4,5,6-d is typically synthesized through the esterification of phthalic ...

Compound Q&A

What industries use Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6)?

Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6) is used in various industries, including pol...

Compound Q&A

What precautions should be taken when handling Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6)?

When handling Mono-Cyclohexyl Phthalate-3,4,5,6-d (CAS: 1398066-18-6), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...