Compound Q&A

What industries use (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4)?

Answer

(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate
(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate is primarily used in the pharmaceutical and semiconductor industries. It serves as an efficient Lewis acid catalyst in various organic reactions, enhances polymerization processes, and is utilized in the development of sensors for detecting organic compounds.

About

English Name (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate
Molecular Formula C20H17F3O4S2
Molecular Weight 442.5 g/mol
SMILES COC1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=CC=C3.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey WBUSZOLVSDXDOC-UHFFFAOYSA-M
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4)?

(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate is a white crystalline solid with a m...

Compound Q&A

How is (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4) typically synthesized?

(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate can be synthesized by a multi-step pr...

Compound Q&A

What precautions should be taken when handling (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4)?

When handling (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate, appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...