Compound Q&A

What are the physical and chemical properties of (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4)?

Answer

(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate
(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate is a white crystalline solid with a molecular weight of approximately 624.5 g/mol. It has a high solubility in non-polar solvents, moderate solubility in polar solvents, and is reactive towards nucleophiles. This compound is typically stable under normal conditions but may decompose at elevated temperatures.

About

English Name (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate
Molecular Formula C20H17F3O4S2
Molecular Weight 442.5 g/mol
SMILES COC1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=CC=C3.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey WBUSZOLVSDXDOC-UHFFFAOYSA-M
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4) typically synthesized?

(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate can be synthesized by a multi-step pr...

Compound Q&A

What industries use (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4)?

(4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate (CAS: 116808-67-4)?

When handling (4-Methoxyphenyl)(diphenyl)sulfonium trifluoromethanesulfonate, appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...