Compound Q&A

What industries use 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0)?

Answer

2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1)
2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) finds applications in the pharmaceutical industry as a potential drug candidate for treating certain metabolic disorders. It is also used in the development of sensors for detecting specific biomolecules and in the preparation of functional polymers for biomedical applications.

About

CAS No 57469-78-0
English Name 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1)
Molecular Formula C22H28N2O5
Molecular Weight 400.48 g/mol
SMILES CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O.C(CCN)CC(C(=O)O)N
InChIKey VHIORVCHBUEWEP-ZSCHJXSPSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0)?

2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0) is a crystalline solid with a m...

Compound Q&A

How is 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0) typically synthesized?

2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) is typically synthesized through the condensation...

Compound Q&A

What precautions should be taken when handling 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0)?

When handling 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...