Compound Q&A

What are the physical and chemical properties of 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0)?

Answer

2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1)
2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0) is a crystalline solid with a molecular weight of approximately 353.32 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophilic aromatic substitution and esterification reactions.

About

CAS No 57469-78-0
English Name 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1)
Molecular Formula C22H28N2O5
Molecular Weight 400.48 g/mol
SMILES CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O.C(CCN)CC(C(=O)O)N
InChIKey VHIORVCHBUEWEP-ZSCHJXSPSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0) typically synthesized?

2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) is typically synthesized through the condensation...

Compound Q&A

What industries use 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0)?

2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) finds applications in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1) (CAS: 57469-78-0)?

When handling 2-(3-Benzoylphenyl)propanoic acid - L-lysine (1:1), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...