Compound Q&A

How is 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2) typically synthesized?

Answer

3-(4-Methoxyphenyl)pyrrolidine hydrochloride
3-(4-Methoxyphenyl)pyrrolidine hydrochloride is commonly synthesized via a multi-step process starting from 4-methoxybenzaldehyde and pyrrolidine. The reaction involves the initial condensation followed by reduction and final protonation. This process requires careful control of pH and temperature to ensure high yield and selectivity. Catalysts such as palladium or rhodium complexes are used to enhance the reaction efficiency.

About

CAS No 91246-25-2
English Name 3-(4-Methoxyphenyl)pyrrolidine hydrochloride
Molecular Formula C11H16ClNO
Molecular Weight 213.71 g/mol
SMILES COC1=CC=C(C=C1)C2CCNC2.Cl
InChIKey BOWGXMBMYJEXOO-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2)?

3-(4-Methoxyphenyl)pyrrolidine hydrochloride is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2)?

3-(4-Methoxyphenyl)pyrrolidine hydrochloride finds applications in the pharmaceutical industry as a ...

Compound Q&A

What precautions should be taken when handling 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2)?

When handling 3-(4-Methoxyphenyl)pyrrolidine hydrochloride, it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...