Compound Q&A

What are the physical and chemical properties of 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2)?

Answer

3-(4-Methoxyphenyl)pyrrolidine hydrochloride
3-(4-Methoxyphenyl)pyrrolidine hydrochloride is a white crystalline solid with a molecular weight of approximately 270.35 g/mol. It has a high solubility in water and organic solvents. Chemically, it is mildly basic due to the presence of a protonated chloride ion, making it readily reactive with various functional groups. It is stable under normal conditions but should be stored away from strong acids and oxidizers.

About

CAS No 91246-25-2
English Name 3-(4-Methoxyphenyl)pyrrolidine hydrochloride
Molecular Formula C11H16ClNO
Molecular Weight 213.71 g/mol
SMILES COC1=CC=C(C=C1)C2CCNC2.Cl
InChIKey BOWGXMBMYJEXOO-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2) typically synthesized?

3-(4-Methoxyphenyl)pyrrolidine hydrochloride is commonly synthesized via a multi-step process starti...

Compound Q&A

What industries use 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2)?

3-(4-Methoxyphenyl)pyrrolidine hydrochloride finds applications in the pharmaceutical industry as a ...

Compound Q&A

What precautions should be taken when handling 3-(4-Methoxyphenyl)pyrrolidine hydrochloride (CAS: 91246-25-2)?

When handling 3-(4-Methoxyphenyl)pyrrolidine hydrochloride, it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...