Compound Q&A

How is 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8) typically synthesized?

Answer

6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
This compound is typically synthesized via an Michael addition followed by a sulfonylation reaction. The Michael addition involves the reaction of an indole with a vinyl electrophile, followed by a sulfonyl chloride to form the sulfonyl derivative. The overall yield can range from 50-70% depending on the reaction conditions. Commonly used catalysts include triphenylphosphine and N,N'-dicyclohexylcarbodiimide (DCC).

About

English Name 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
Molecular Formula C22H15F2N5O3S
Molecular Weight 467.46 g/mol
SMILES Cn1c2c(cc(c1=O)S(=O)(=O)c3ccc(cc3F)F)cnc(n2)Nc4ccc5c(c4)cc[nH]5
InChIKey ZEHBZHZMQSHZFI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8)?

This compound is a crystalline solid with a high melting point of around 320°C. Its molecular weight...

Compound Q&A

What industries use 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8)?

This compound is used in pharmaceuticals for its potential as an antiviral agent. It is also used in...

Compound Q&A

What precautions should be taken when handling 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8)?

When handling this compound, ensure proper personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...