Compound Q&A

What are the physical and chemical properties of 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8)?

Answer

6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
This compound is a crystalline solid with a high melting point of around 320°C. Its molecular weight is approximately 463.38 g/mol. It has low water solubility but good solubility in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). Chemically, it is moderately reactive, showing good stability under normal conditions but can react with nucleophiles under basic conditions. It is not readily hydrolyzed or oxidized.

About

English Name 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
Molecular Formula C22H15F2N5O3S
Molecular Weight 467.46 g/mol
SMILES Cn1c2c(cc(c1=O)S(=O)(=O)c3ccc(cc3F)F)cnc(n2)Nc4ccc5c(c4)cc[nH]5
InChIKey ZEHBZHZMQSHZFI-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8) typically synthesized?

This compound is typically synthesized via an Michael addition followed by a sulfonylation reaction....

Compound Q&A

What industries use 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8)?

This compound is used in pharmaceuticals for its potential as an antiviral agent. It is also used in...

Compound Q&A

What precautions should be taken when handling 6-[(2,4-Difluorophenyl)sulfonyl]-2-(1H-indol-5-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one (CAS: 1312471-39-8)?

When handling this compound, ensure proper personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...