Compound Q&A

What industries use (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3)?

Answer

(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid
(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) is primarily used in the pharmaceutical industry for the synthesis of certain drugs due to its unique chemical properties. It may also find applications in the polymer industry for the development of specialized materials and in the sensor technology for its reactivity and stability.

About

CAS No 89581-61-3
English Name (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid
Molecular Formula C6H5ClN2O3
Molecular Weight 188.57 g/mol
SMILES C1=CC(=O)N(N=C1Cl)CC(=O)O
InChIKey NJHHVYWIVRTAAP-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3)?

(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) is a crystalline solid with a molecu...

Compound Q&A

How is (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) typically synthesized?

(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) is usually synthesized via the conde...

Compound Q&A

What precautions should be taken when handling (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3)?

When handling (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3), it is essential to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...