Compound Q&A

What are the physical and chemical properties of (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3)?

Answer

(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid
(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) is a crystalline solid with a molecular weight of approximately 220.58 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and methanol. The compound is moderately reactive, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored away from moisture and heat.

About

CAS No 89581-61-3
English Name (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid
Molecular Formula C6H5ClN2O3
Molecular Weight 188.57 g/mol
SMILES C1=CC(=O)N(N=C1Cl)CC(=O)O
InChIKey NJHHVYWIVRTAAP-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) typically synthesized?

(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) is usually synthesized via the conde...

Compound Q&A

What industries use (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3)?

(3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3)?

When handling (3-chloro-6-oxopyridazin-1(6H)-yl)acetic acid (CAS: 89581-61-3), it is essential to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...