Compound Q&A

What are the physical and chemical properties of (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid (CAS: 511272-35-8)?

Answer

(R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid
The compound has a crystalline form, with a molecular weight of approximately 444.45 g/mol. It is sparingly soluble in water but soluble in organic solvents like methanol and ethanol. Chemically, it is relatively stable but can react with strong bases. It has a specific reactivity profile suitable for coupling reactions and esterification processes.

About

English Name (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid
Molecular Formula C24H21NO5
Molecular Weight 403.43 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC(=CC=C4)O
InChIKey LZJDAHKCUYUTCN-JOCHJYFZSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid (CAS: 511272-35-8) typically synthesized?

It is commonly synthesized via a multi-step process involving a fluorenylmethoxycarbonyl (Fmoc) prot...

Compound Q&A

What industries use (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid (CAS: 511272-35-8)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What precautions should be taken when handling (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid (CAS: 511272-35-8)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...