Compound Q&A

What industries use hexyl(diphenyl)phosphine (CAS: 18298-00-5)?

Answer

Hexyl(diphenyl)phosphine
Hexyl(diphenyl)phosphine is used in various industries, including pharmaceuticals for the synthesis of certain organic compounds, polymers for the modification of polymer properties, and sensors for detecting specific chemical species. It also finds applications in the semiconductor industry as a precursor in the production of phosphorus-containing compounds.

About

CAS No 18298-00-5
English Name Hexyl(diphenyl)phosphine
Molecular Formula C18H23P
Molecular Weight 270.35600000000005 g/mol
SMILES CCCCCCP(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey WHNGQRQJGDUZPJ-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of hexyl(diphenyl)phosphine (CAS: 18298-00-5)?

Hexyl(diphenyl)phosphine is a colorless to light yellow liquid with a molecular weight of approximat...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnesium bromide with pho...

Compound Q&A

What precautions should be taken when handling hexyl(diphenyl)phosphine (CAS: 18298-00-5)?

When handling hexyl(diphenyl)phosphine, it is essential to use appropriate personal protective equip...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene